C8H11FN2O3S — CID 15383361
3-(2-amino-1-hydroxyethyl)-4-fluorobenzenesulfonamide (PubChem CID 15383361) has the molecular formula C8H11FN2O3S and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-(2-amino-1-hydroxyethyl)-4-fluorobenzenesulfonamide.
| Compound Name | 3-(2-amino-1-hydroxyethyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 15383361 |
| Molecular Formula | C8H11FN2O3S |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3-(2-amino-1-hydroxyethyl)-4-fluorobenzenesulfonamide |
| SMILES | NCC(O)c1cc(S(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C8H11FN2O3S/c9-7-2-1-5(15(11,13)14)3-6(7)8(12)4-10/h1-3,8,12H,4,10H2,(H2,11,13,14) |
| InChIKey | LVLVILNNIYRTAM-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |