C8H9F2NO2 — CID 117281266
5-(2-amino-1-hydroxyethyl)-2,4-difluorophenol (PubChem CID 117281266) has the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. Its IUPAC name is 5-(2-amino-1-hydroxyethyl)-2,4-difluorophenol.
| Compound Name | 5-(2-amino-1-hydroxyethyl)-2,4-difluorophenol |
|---|---|
| PubChem CID | 117281266 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 5-(2-amino-1-hydroxyethyl)-2,4-difluorophenol |
| SMILES | NCC(O)c1cc(O)c(F)cc1F |
| InChI | InChI=1S/C8H9F2NO2/c9-5-2-6(10)7(12)1-4(5)8(13)3-11/h1-2,8,12-13H,3,11H2 |
| InChIKey | MXBQBLCGACPEIF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |