C9H11F2NOS — CID 117312254
2-amino-1-(2,5-difluoro-4-methylsulfanylphenyl)ethanol (PubChem CID 117312254) has the molecular formula C9H11F2NOS and a molecular weight of 219.26 g/mol. Its IUPAC name is 2-amino-1-(2,5-difluoro-4-methylsulfanylphenyl)ethanol.
| Compound Name | 2-amino-1-(2,5-difluoro-4-methylsulfanylphenyl)ethanol |
|---|---|
| PubChem CID | 117312254 |
| Molecular Formula | C9H11F2NOS |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-amino-1-(2,5-difluoro-4-methylsulfanylphenyl)ethanol |
| SMILES | CSc1cc(F)c(C(O)CN)cc1F |
| InChI | InChI=1S/C9H11F2NOS/c1-14-9-3-6(10)5(2-7(9)11)8(13)4-12/h2-3,8,13H,4,12H2,1H3 |
| InChIKey | LZISQJRIQUMJTM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |