C8H7F4NO — CID 18627999
2-amino-1-(2,3,4,5-tetrafluorophenyl)ethanol (PubChem CID 18627999) has the molecular formula C8H7F4NO and a molecular weight of 209.14 g/mol. Its IUPAC name is 2-amino-1-(2,3,4,5-tetrafluorophenyl)ethanol.
| Compound Name | 2-amino-1-(2,3,4,5-tetrafluorophenyl)ethanol |
|---|---|
| PubChem CID | 18627999 |
| Molecular Formula | C8H7F4NO |
| Molecular Weight | 209.14 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-amino-1-(2,3,4,5-tetrafluorophenyl)ethanol |
| SMILES | NCC(O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H7F4NO/c9-4-1-3(5(14)2-13)6(10)8(12)7(4)11/h1,5,14H,2,13H2 |
| InChIKey | DWCHNZBWZDNANO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.14 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|