C14H4F10S2 — CID 20977462
1,2,3,4-tetrafluoro-5-[fluoro-[[fluoro-(2,3,4,5-tetrafluorophenyl)methyl]disulfanyl]methyl]benzene (PubChem CID 20977462) has the molecular formula C14H4F10S2 and a molecular weight of 426.30 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5-[fluoro-[[fluoro-(2,3,4,5-tetrafluorophenyl)methyl]disulfanyl]methyl]benzene.
| Compound Name | 1,2,3,4-tetrafluoro-5-[fluoro-[[fluoro-(2,3,4,5-tetrafluorophenyl)methyl]disulfanyl]methyl]benzene |
|---|---|
| PubChem CID | 20977462 |
| Molecular Formula | C14H4F10S2 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5-[fluoro-[[fluoro-(2,3,4,5-tetrafluorophenyl)methyl]disulfanyl]methyl]benzene |
| SMILES | Fc1cc(C(F)SSC(F)c2cc(F)c(F)c(F)c2F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H4F10S2/c15-5-1-3(7(17)11(21)9(5)19)13(23)25-26-14(24)4-2-6(16)10(20)12(22)8(4)18/h1-2,13-14H |
| InChIKey | HNRVFMAVBSOYHP-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|