C12H12F6 — CID 90872484
1-(1,6-difluorohexyl)-2,3,4,5-tetrafluorobenzene (PubChem CID 90872484) has the molecular formula C12H12F6 and a molecular weight of 270.22 g/mol. Its IUPAC name is 1-(1,6-difluorohexyl)-2,3,4,5-tetrafluorobenzene.
| Compound Name | 1-(1,6-difluorohexyl)-2,3,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 90872484 |
| Molecular Formula | C12H12F6 |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1-(1,6-difluorohexyl)-2,3,4,5-tetrafluorobenzene |
| SMILES | FCCCCCC(F)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F6/c13-5-3-1-2-4-8(14)7-6-9(15)11(17)12(18)10(7)16/h6,8H,1-5H2 |
| InChIKey | GAHTXCUOYWXOSW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|