C12H18F2N+ — CID 22348881
[2-(1,6-difluorohexyl)phenyl]azanium (PubChem CID 22348881) has the molecular formula C12H18F2N+ and a molecular weight of 214.28 g/mol. Its IUPAC name is [2-(1,6-difluorohexyl)phenyl]azanium.
| Compound Name | [2-(1,6-difluorohexyl)phenyl]azanium |
|---|---|
| PubChem CID | 22348881 |
| Molecular Formula | C12H18F2N+ |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | [2-(1,6-difluorohexyl)phenyl]azanium |
| SMILES | [NH3+]c1ccccc1C(F)CCCCCF |
| InChI | InChI=1S/C12H17F2N/c13-9-5-1-2-7-11(14)10-6-3-4-8-12(10)15/h3-4,6,8,11H,1-2,5,7,9,15H2/p+1 |
| InChIKey | HPBMYFFNFFFIOI-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|