C13H17F5OSi — CID 90173423
[fluoro-(2,3,4,5-tetrafluorophenyl)methyl]-hydroxy-di(propan-2-yl)silane (PubChem CID 90173423) has the molecular formula C13H17F5OSi and a molecular weight of 312.35 g/mol. Its IUPAC name is [fluoro-(2,3,4,5-tetrafluorophenyl)methyl]-hydroxy-di(propan-2-yl)silane.
| Compound Name | [fluoro-(2,3,4,5-tetrafluorophenyl)methyl]-hydroxy-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 90173423 |
| Molecular Formula | C13H17F5OSi |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [fluoro-(2,3,4,5-tetrafluorophenyl)methyl]-hydroxy-di(propan-2-yl)silane |
| SMILES | CC(C)[Si](O)(C(C)C)C(F)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H17F5OSi/c1-6(2)20(19,7(3)4)13(18)8-5-9(14)11(16)12(17)10(8)15/h5-7,13,19H,1-4H3 |
| InChIKey | LBUPOZPEFQTSRR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|