C8H8F4N2 — CID 66516916
(1S)-1-(2,3,4,5-tetrafluorophenyl)ethane-1,2-diamine (PubChem CID 66516916) has the molecular formula C8H8F4N2 and a molecular weight of 208.16 g/mol. Its IUPAC name is (1S)-1-(2,3,4,5-tetrafluorophenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(2,3,4,5-tetrafluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66516916 |
| Molecular Formula | C8H8F4N2 |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (1S)-1-(2,3,4,5-tetrafluorophenyl)ethane-1,2-diamine |
| SMILES | NC[C@@H](N)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H8F4N2/c9-4-1-3(5(14)2-13)6(10)8(12)7(4)11/h1,5H,2,13-14H2/t5-/m1/s1 |
| InChIKey | SZVMJFSKZZPGEU-RXMQYKEDSA-N |
| XLogP | 1.20 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|