C9H12BrFN2 — CID 130731681
(1R)-1-(5-bromo-2-fluoro-3-methylphenyl)ethane-1,2-diamine (PubChem CID 130731681) has the molecular formula C9H12BrFN2 and a molecular weight of 247.11 g/mol. Its IUPAC name is (1R)-1-(5-bromo-2-fluoro-3-methylphenyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(5-bromo-2-fluoro-3-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130731681 |
| Molecular Formula | C9H12BrFN2 |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | (1R)-1-(5-bromo-2-fluoro-3-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1cc(Br)cc([C@@H](N)CN)c1F |
| InChI | InChI=1S/C9H12BrFN2/c1-5-2-6(10)3-7(9(5)11)8(13)4-12/h2-3,8H,4,12-13H2,1H3/t8-/m0/s1 |
| InChIKey | PPFYDIMEDDYIGM-QMMMGPOBSA-N |
| XLogP | 1.86 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |