C13H18BrClFN — CID 171224555
(S)-(5-bromo-2-fluoro-3-methylphenyl)-cyclopentylmethanamine;hydrochloride (PubChem CID 171224555) has the molecular formula C13H18BrClFN and a molecular weight of 322.65 g/mol. Its IUPAC name is (S)-(5-bromo-2-fluoro-3-methylphenyl)-cyclopentylmethanamine;hydrochloride.
| Compound Name | (S)-(5-bromo-2-fluoro-3-methylphenyl)-cyclopentylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171224555 |
| Molecular Formula | C13H18BrClFN |
| Molecular Weight | 322.65 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | (S)-(5-bromo-2-fluoro-3-methylphenyl)-cyclopentylmethanamine;hydrochloride |
| SMILES | Cc1cc(Br)cc([C@@H](N)C2CCCC2)c1F.Cl |
| InChI | InChI=1S/C13H17BrFN.ClH/c1-8-6-10(14)7-11(12(8)15)13(16)9-4-2-3-5-9;/h6-7,9,13H,2-5,16H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | VDPVJHOQVBPITL-ZOWNYOTGSA-N |
| XLogP | 4.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |