C8H10F3N3 — CID 66517130
(1S)-1-(2-amino-3,5,6-trifluorophenyl)ethane-1,2-diamine (PubChem CID 66517130) has the molecular formula C8H10F3N3 and a molecular weight of 205.18 g/mol. Its IUPAC name is (1S)-1-(2-amino-3,5,6-trifluorophenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(2-amino-3,5,6-trifluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517130 |
| Molecular Formula | C8H10F3N3 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | (1S)-1-(2-amino-3,5,6-trifluorophenyl)ethane-1,2-diamine |
| SMILES | NC[C@@H](N)c1c(N)c(F)cc(F)c1F |
| InChI | InChI=1S/C8H10F3N3/c9-3-1-4(10)8(14)6(7(3)11)5(13)2-12/h1,5H,2,12-14H2/t5-/m1/s1 |
| InChIKey | QVAPUZQYCZKMBT-RXMQYKEDSA-N |
| XLogP | 0.64 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|