C12H15F5P+ — CID 22348710
1,6-difluorohexyl-(2,3,5-trifluorophenyl)phosphanium (PubChem CID 22348710) has the molecular formula C12H15F5P+ and a molecular weight of 285.22 g/mol. Its IUPAC name is 1,6-difluorohexyl-(2,3,5-trifluorophenyl)phosphanium.
| Compound Name | 1,6-difluorohexyl-(2,3,5-trifluorophenyl)phosphanium |
|---|---|
| PubChem CID | 22348710 |
| Molecular Formula | C12H15F5P+ |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 1,6-difluorohexyl-(2,3,5-trifluorophenyl)phosphanium |
| SMILES | FCCCCCC(F)[PH2+]c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C12H14F5P/c13-5-3-1-2-4-11(16)18-10-7-8(14)6-9(15)12(10)17/h6-7,11,18H,1-5H2/p+1 |
| InChIKey | IBRVCSREHOKBMW-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|