C17H19F10P — CID 23123071
ethyl-(2,3,4,5,6,9-hexafluorononyl)-(2,3,4,5-tetrafluorophenyl)phosphane (PubChem CID 23123071) has the molecular formula C17H19F10P and a molecular weight of 444.29 g/mol. Its IUPAC name is ethyl-(2,3,4,5,6,9-hexafluorononyl)-(2,3,4,5-tetrafluorophenyl)phosphane.
| Compound Name | ethyl-(2,3,4,5,6,9-hexafluorononyl)-(2,3,4,5-tetrafluorophenyl)phosphane |
|---|---|
| PubChem CID | 23123071 |
| Molecular Formula | C17H19F10P |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | ethyl-(2,3,4,5,6,9-hexafluorononyl)-(2,3,4,5-tetrafluorophenyl)phosphane |
| SMILES | CCP(CC(F)C(F)C(F)C(F)C(F)CCCF)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H19F10P/c1-2-28(11-6-9(20)13(23)17(27)15(11)25)7-10(21)14(24)16(26)12(22)8(19)4-3-5-18/h6,8,10,12,14,16H,2-5,7H2,1H3 |
| InChIKey | XOAOHLQLWWTEDB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|