C16H18F9N — CID 23123274
2,5-difluoro-N-(fluoromethyl)-N-(2,3,4,5,6,9-hexafluorononyl)aniline (PubChem CID 23123274) has the molecular formula C16H18F9N and a molecular weight of 395.31 g/mol. Its IUPAC name is 2,5-difluoro-N-(fluoromethyl)-N-(2,3,4,5,6,9-hexafluorononyl)aniline.
| Compound Name | 2,5-difluoro-N-(fluoromethyl)-N-(2,3,4,5,6,9-hexafluorononyl)aniline |
|---|---|
| PubChem CID | 23123274 |
| Molecular Formula | C16H18F9N |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2,5-difluoro-N-(fluoromethyl)-N-(2,3,4,5,6,9-hexafluorononyl)aniline |
| SMILES | FCCCC(F)C(F)C(F)C(F)C(F)CN(CF)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H18F9N/c17-5-1-2-11(21)14(23)16(25)15(24)12(22)7-26(8-18)13-6-9(19)3-4-10(13)20/h3-4,6,11-12,14-16H,1-2,5,7-8H2 |
| InChIKey | UEKZJXIERUEXMN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|