C24H37F6N — CID 23123344
N-(3-ethylheptyl)-N-(2,3,4,5,6,9-hexafluorononyl)aniline (PubChem CID 23123344) has the molecular formula C24H37F6N and a molecular weight of 453.56 g/mol. Its IUPAC name is N-(3-ethylheptyl)-N-(2,3,4,5,6,9-hexafluorononyl)aniline.
| Compound Name | N-(3-ethylheptyl)-N-(2,3,4,5,6,9-hexafluorononyl)aniline |
|---|---|
| PubChem CID | 23123344 |
| Molecular Formula | C24H37F6N |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | N-(3-ethylheptyl)-N-(2,3,4,5,6,9-hexafluorononyl)aniline |
| SMILES | CCCCC(CC)CCN(CC(F)C(F)C(F)C(F)C(F)CCCF)c1ccccc1 |
| InChI | InChI=1S/C24H37F6N/c1-3-5-10-18(4-2)14-16-31(19-11-7-6-8-12-19)17-21(27)23(29)24(30)22(28)20(26)13-9-15-25/h6-8,11-12,18,20-24H,3-5,9-10,13-17H2,1-2H3 |
| InChIKey | VWPHGSDGYRWBKH-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |