C12H17F2NO — CID 115250646
2-[(2,5-difluoro-N-methylanilino)methyl]butan-1-ol (PubChem CID 115250646) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is 2-[(2,5-difluoro-N-methylanilino)methyl]butan-1-ol.
| Compound Name | 2-[(2,5-difluoro-N-methylanilino)methyl]butan-1-ol |
|---|---|
| PubChem CID | 115250646 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-[(2,5-difluoro-N-methylanilino)methyl]butan-1-ol |
| SMILES | CCC(CO)CN(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H17F2NO/c1-3-9(8-16)7-15(2)12-6-10(13)4-5-11(12)14/h4-6,9,16H,3,7-8H2,1-2H3 |
| InChIKey | SQLQLZOWYYYSSU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |