C8H11F2N3 — CID 115260602
2,5-difluoro-N-(hydrazinylmethyl)-N-methylaniline (PubChem CID 115260602) has the molecular formula C8H11F2N3 and a molecular weight of 187.19 g/mol. Its IUPAC name is 2,5-difluoro-N-(hydrazinylmethyl)-N-methylaniline.
| Compound Name | 2,5-difluoro-N-(hydrazinylmethyl)-N-methylaniline |
|---|---|
| PubChem CID | 115260602 |
| Molecular Formula | C8H11F2N3 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 2,5-difluoro-N-(hydrazinylmethyl)-N-methylaniline |
| SMILES | CN(CNN)c1cc(F)ccc1F |
| InChI | InChI=1S/C8H11F2N3/c1-13(5-12-11)8-4-6(9)2-3-7(8)10/h2-4,12H,5,11H2,1H3 |
| InChIKey | DFBQVIDHQYZTPJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|