C11H11F2NO2 — CID 115176272
N-(2,5-difluorophenyl)-N-methyl-3-oxobutanamide (PubChem CID 115176272) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-N-methyl-3-oxobutanamide.
| Compound Name | N-(2,5-difluorophenyl)-N-methyl-3-oxobutanamide |
|---|---|
| PubChem CID | 115176272 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | N-(2,5-difluorophenyl)-N-methyl-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)N(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H11F2NO2/c1-7(15)5-11(16)14(2)10-6-8(12)3-4-9(10)13/h3-4,6H,5H2,1-2H3 |
| InChIKey | YGVCKEDAKKBLSV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|