C13H13F2NO3 — CID 115183843
1-[(2,5-difluorophenyl)-methylcarbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 115183843) has the molecular formula C13H13F2NO3 and a molecular weight of 269.25 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)-methylcarbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(2,5-difluorophenyl)-methylcarbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115183843 |
| Molecular Formula | C13H13F2NO3 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-[(2,5-difluorophenyl)-methylcarbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | CN(C(=O)C1(C(=O)O)CCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H13F2NO3/c1-16(10-7-8(14)3-4-9(10)15)11(17)13(12(18)19)5-2-6-13/h3-4,7H,2,5-6H2,1H3,(H,18,19) |
| InChIKey | BIXCECKXKHHRJZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|