C21H27F10P — CID 23123231
2,3,4,5,6,9-hexafluorononyl-(2-methylpentyl)-(2,3,4,5-tetrafluorophenyl)phosphane (PubChem CID 23123231) has the molecular formula C21H27F10P and a molecular weight of 500.40 g/mol. Its IUPAC name is 2,3,4,5,6,9-hexafluorononyl-(2-methylpentyl)-(2,3,4,5-tetrafluorophenyl)phosphane.
| Compound Name | 2,3,4,5,6,9-hexafluorononyl-(2-methylpentyl)-(2,3,4,5-tetrafluorophenyl)phosphane |
|---|---|
| PubChem CID | 23123231 |
| Molecular Formula | C21H27F10P |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 2,3,4,5,6,9-hexafluorononyl-(2-methylpentyl)-(2,3,4,5-tetrafluorophenyl)phosphane |
| SMILES | CCCC(C)CP(CC(F)C(F)C(F)C(F)C(F)CCCF)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H27F10P/c1-3-5-11(2)9-32(15-8-13(24)17(27)21(31)19(15)29)10-14(25)18(28)20(30)16(26)12(23)6-4-7-22/h8,11-12,14,16,18,20H,3-7,9-10H2,1-2H3 |
| InChIKey | ZGYIAPHJQFWTHV-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|