C8H8ClF2NO2 — CID 84789353
4-(2-amino-1-hydroxyethyl)-2-chloro-3,5-difluorophenol (PubChem CID 84789353) has the molecular formula C8H8ClF2NO2 and a molecular weight of 223.61 g/mol. Its IUPAC name is 4-(2-amino-1-hydroxyethyl)-2-chloro-3,5-difluorophenol.
| Compound Name | 4-(2-amino-1-hydroxyethyl)-2-chloro-3,5-difluorophenol |
|---|---|
| PubChem CID | 84789353 |
| Molecular Formula | C8H8ClF2NO2 |
| Molecular Weight | 223.61 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 4-(2-amino-1-hydroxyethyl)-2-chloro-3,5-difluorophenol |
| SMILES | NCC(O)c1c(F)cc(O)c(Cl)c1F |
| InChI | InChI=1S/C8H8ClF2NO2/c9-7-4(13)1-3(10)6(8(7)11)5(14)2-12/h1,5,13-14H,2,12H2 |
| InChIKey | RIEHRIGVVDPUQN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.61 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|