C15H23FN2O3S — CID 136559017
4-[1-[(1-cyclopentyl-2-hydroxyethyl)amino]ethyl]-3-fluorobenzenesulfonamide (PubChem CID 136559017) has the molecular formula C15H23FN2O3S and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-[1-[(1-cyclopentyl-2-hydroxyethyl)amino]ethyl]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[1-[(1-cyclopentyl-2-hydroxyethyl)amino]ethyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 136559017 |
| Molecular Formula | C15H23FN2O3S |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-[1-[(1-cyclopentyl-2-hydroxyethyl)amino]ethyl]-3-fluorobenzenesulfonamide |
| SMILES | CC(NC(CO)C1CCCC1)c1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C15H23FN2O3S/c1-10(18-15(9-19)11-4-2-3-5-11)13-7-6-12(8-14(13)16)22(17,20)21/h6-8,10-11,15,18-19H,2-5,9H2,1H3,(H2,17,20,21) |
| InChIKey | HCHVNYKXHIMVCS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |