C14H15FO3 — CID 171873026
1-(4-fluoronaphthalen-1-yl)butane-1,2,4-triol (PubChem CID 171873026) has the molecular formula C14H15FO3 and a molecular weight of 250.27 g/mol. Its IUPAC name is 1-(4-fluoronaphthalen-1-yl)butane-1,2,4-triol.
| Compound Name | 1-(4-fluoronaphthalen-1-yl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171873026 |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-(4-fluoronaphthalen-1-yl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C14H15FO3/c15-12-6-5-11(14(18)13(17)7-8-16)9-3-1-2-4-10(9)12/h1-6,13-14,16-18H,7-8H2 |
| InChIKey | IOQSRXVUZJLNDB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |