C10H11ClF2O3 — CID 171872120
1-(3-chloro-2,4-difluorophenyl)butane-1,2,4-triol (PubChem CID 171872120) has the molecular formula C10H11ClF2O3 and a molecular weight of 252.64 g/mol. Its IUPAC name is 1-(3-chloro-2,4-difluorophenyl)butane-1,2,4-triol.
| Compound Name | 1-(3-chloro-2,4-difluorophenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872120 |
| Molecular Formula | C10H11ClF2O3 |
| Molecular Weight | 252.64 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1-(3-chloro-2,4-difluorophenyl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C10H11ClF2O3/c11-8-6(12)2-1-5(9(8)13)10(16)7(15)3-4-14/h1-2,7,10,14-16H,3-4H2 |
| InChIKey | FOVIEKQNYZDNMW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.64 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|