C9H10ClF2NO — CID 84788312
3-amino-3-(3-chloro-2,4-difluorophenyl)propan-1-ol (PubChem CID 84788312) has the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. Its IUPAC name is 3-amino-3-(3-chloro-2,4-difluorophenyl)propan-1-ol.
| Compound Name | 3-amino-3-(3-chloro-2,4-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 84788312 |
| Molecular Formula | C9H10ClF2NO |
| Molecular Weight | 221.63 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 3-amino-3-(3-chloro-2,4-difluorophenyl)propan-1-ol |
| SMILES | NC(CCO)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C9H10ClF2NO/c10-8-6(11)2-1-5(9(8)12)7(13)3-4-14/h1-2,7,14H,3-4,13H2 |
| InChIKey | CKGVGGKFZZBGDB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.63 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|