C9H11F2NO3 — CID 171872056
1-(2,6-difluoro-3-pyridinyl)butane-1,2,4-triol (PubChem CID 171872056) has the molecular formula C9H11F2NO3 and a molecular weight of 219.19 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(2,6-difluoro-3-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872056 |
| Molecular Formula | C9H11F2NO3 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 1-(2,6-difluoro-3-pyridinyl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1ccc(F)nc1F |
| InChI | InChI=1S/C9H11F2NO3/c10-7-2-1-5(9(11)12-7)8(15)6(14)3-4-13/h1-2,6,8,13-15H,3-4H2 |
| InChIKey | KCAMNQRQOHJBIG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|