C12H15ClO5 — CID 171872843
2-[4-chloro-2-(1,2,4-trihydroxybutyl)phenyl]acetic acid (PubChem CID 171872843) has the molecular formula C12H15ClO5 and a molecular weight of 274.70 g/mol. Its IUPAC name is 2-[4-chloro-2-(1,2,4-trihydroxybutyl)phenyl]acetic acid.
| Compound Name | 2-[4-chloro-2-(1,2,4-trihydroxybutyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 171872843 |
| Molecular Formula | C12H15ClO5 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[4-chloro-2-(1,2,4-trihydroxybutyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Cl)cc1C(O)C(O)CCO |
| InChI | InChI=1S/C12H15ClO5/c13-8-2-1-7(5-11(16)17)9(6-8)12(18)10(15)3-4-14/h1-2,6,10,12,14-15,18H,3-5H2,(H,16,17) |
| InChIKey | CUNSOEGMJWSSEM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |