About methyl (6-nitro-1H-indol-3-yl) carbonate
methyl (6-nitro-1H-indol-3-yl) carbonate (PubChem CID 57207350) has the molecular formula C10H8N2O5
and a molecular weight of 236.18 g/mol. Its IUPAC name is methyl (6-nitro-1H-indol-3-yl) carbonate.
Molecular Properties
| Compound Name | methyl (6-nitro-1H-indol-3-yl) carbonate |
| PubChem CID | 57207350 |
| Molecular Formula | C10H8N2O5 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | methyl (6-nitro-1H-indol-3-yl) carbonate |
| SMILES | COC(=O)Oc1c[nH]c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C10H8N2O5/c1-16-10(13)17-9-5-11-8-4-6(12(14)15)2-3-7(8)9/h2-5,11H,1H3 |
| InChIKey | KWLCSUNJQFTOSZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (6-nitro-1H-indol-3-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (6-nitro-1H-indol-3-yl) carbonate?
The IUPAC name of methyl (6-nitro-1H-indol-3-yl) carbonate (CID 57207350) is methyl (6-nitro-1H-indol-3-yl) carbonate.
What is the SMILES notation for methyl (6-nitro-1H-indol-3-yl) carbonate?
The canonical SMILES for methyl (6-nitro-1H-indol-3-yl) carbonate is COC(=O)Oc1c[nH]c2cc([N+](=O)[O-])ccc12.
What is the InChIKey of methyl (6-nitro-1H-indol-3-yl) carbonate?
The InChIKey is KWLCSUNJQFTOSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O5/c1-16-10(13)17-9-5-11-8-4-6(12(14)15)2-3-7(8)9/h2-5,11H,1H3.
What are the key properties of methyl (6-nitro-1H-indol-3-yl) carbonate?
methyl (6-nitro-1H-indol-3-yl) carbonate has a molecular weight of 236.18 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6-nitro-1H-indol-3-yl) carbonate is sourced from PubChem (CID 57207350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).