C16H20N2O3 — CID 63834645
3,4,4-trimethyl-1-(6-nitro-1H-indol-3-yl)pentan-1-one (PubChem CID 63834645) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3,4,4-trimethyl-1-(6-nitro-1H-indol-3-yl)pentan-1-one.
| Compound Name | 3,4,4-trimethyl-1-(6-nitro-1H-indol-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 63834645 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3,4,4-trimethyl-1-(6-nitro-1H-indol-3-yl)pentan-1-one |
| SMILES | CC(CC(=O)c1c[nH]c2cc([N+](=O)[O-])ccc12)C(C)(C)C |
| InChI | InChI=1S/C16H20N2O3/c1-10(16(2,3)4)7-15(19)13-9-17-14-8-11(18(20)21)5-6-12(13)14/h5-6,8-10,17H,7H2,1-4H3 |
| InChIKey | UJEKZDUJZCXEOM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|