C15H14F3N3O5 — CID 600253
ethyl 3-(6-nitro-1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 600253) has the molecular formula C15H14F3N3O5 and a molecular weight of 373.29 g/mol. Its IUPAC name is ethyl 3-(6-nitro-1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | ethyl 3-(6-nitro-1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 600253 |
| Molecular Formula | C15H14F3N3O5 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | ethyl 3-(6-nitro-1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | CCOC(=O)C(Cc1c[nH]c2cc([N+](=O)[O-])ccc12)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H14F3N3O5/c1-2-26-13(22)12(20-14(23)15(16,17)18)5-8-7-19-11-6-9(21(24)25)3-4-10(8)11/h3-4,6-7,12,19H,2,5H2,1H3,(H,20,23) |
| InChIKey | CWMGFGMLKLRZEB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|