C21H22N4O6 — CID 6427020
butyl (2R)-2-(2,4-dinitroanilino)-3-(1H-indol-3-yl)propanoate (PubChem CID 6427020) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is butyl (2R)-2-(2,4-dinitroanilino)-3-(1H-indol-3-yl)propanoate.
| Compound Name | butyl (2R)-2-(2,4-dinitroanilino)-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 6427020 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | butyl (2R)-2-(2,4-dinitroanilino)-3-(1H-indol-3-yl)propanoate |
| SMILES | CCCCOC(=O)[C@@H](Cc1c[nH]c2ccccc12)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N4O6/c1-2-3-10-31-21(26)19(11-14-13-22-17-7-5-4-6-16(14)17)23-18-9-8-15(24(27)28)12-20(18)25(29)30/h4-9,12-13,19,22-23H,2-3,10-11H2,1H3/t19-/m1/s1 |
| InChIKey | FOLAZZPMGGTUJX-LJQANCHMSA-N |
| XLogP | 4.35 |
| TPSA | 140.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|