C26H37N3O6 — CID 22216507
butyl (4S)-4-acetamido-5-[[(2S)-1-butoxy-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoate (PubChem CID 22216507) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is butyl (4S)-4-acetamido-5-[[(2S)-1-butoxy-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoate.
| Compound Name | butyl (4S)-4-acetamido-5-[[(2S)-1-butoxy-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 22216507 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | butyl (4S)-4-acetamido-5-[[(2S)-1-butoxy-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoate |
| SMILES | CCCCOC(=O)CC[C@H](NC(C)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCCCC |
| InChI | InChI=1S/C26H37N3O6/c1-4-6-14-34-24(31)13-12-22(28-18(3)30)25(32)29-23(26(33)35-15-7-5-2)16-19-17-27-21-11-9-8-10-20(19)21/h8-11,17,22-23,27H,4-7,12-16H2,1-3H3,(H,28,30)(H,29,32)/t22-,23-/m0/s1 |
| InChIKey | BPWNPLDLSUOTRF-GOTSBHOMSA-N |
| XLogP | 3.17 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|