C24H34N6O6 — CID 135333021
2-acetamido-N-[1-[[1-(hydroxyamino)-3-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]pentanediamide (PubChem CID 135333021) has the molecular formula C24H34N6O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is 2-acetamido-N-[1-[[1-(hydroxyamino)-3-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]pentanediamide.
| Compound Name | 2-acetamido-N-[1-[[1-(hydroxyamino)-3-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 135333021 |
| Molecular Formula | C24H34N6O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 2-acetamido-N-[1-[[1-(hydroxyamino)-3-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]pentanediamide |
| SMILES | CCC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCC(N)=O)NC(C)=O)C(=O)NO |
| InChI | InChI=1S/C24H34N6O6/c1-4-13(2)21(24(35)30-36)29-23(34)19(11-15-12-26-17-8-6-5-7-16(15)17)28-22(33)18(27-14(3)31)9-10-20(25)32/h5-8,12-13,18-19,21,26,36H,4,9-11H2,1-3H3,(H2,25,32)(H,27,31)(H,28,33)(H,29,34)(H,30,35) |
| InChIKey | DNFTXTJITJAHDW-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 195.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|