C31H40N6O6 — CID 19944636
2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 19944636) has the molecular formula C31H40N6O6 and a molecular weight of 592.70 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 19944636 |
| Molecular Formula | C31H40N6O6 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H40N6O6/c1-3-18(2)27(30(41)36-25(31(42)43)15-19-9-5-4-6-10-19)37-29(40)24(13-14-26(33)38)35-28(39)22(32)16-20-17-34-23-12-8-7-11-21(20)23/h4-12,17-18,22,24-25,27,34H,3,13-16,32H2,1-2H3,(H2,33,38)(H,35,39)(H,36,41)(H,37,40)(H,42,43) |
| InChIKey | JFVDHKNIEZSXIB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 209.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |