C31H40N6O7 — CID 19944641
2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 19944641) has the molecular formula C31H40N6O7 and a molecular weight of 608.70 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 19944641 |
| Molecular Formula | C31H40N6O7 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C31H40N6O7/c1-3-17(2)27(30(42)36-25(31(43)44)14-18-8-10-20(38)11-9-18)37-29(41)24(12-13-26(33)39)35-28(40)22(32)15-19-16-34-23-7-5-4-6-21(19)23/h4-11,16-17,22,24-25,27,34,38H,3,12-15,32H2,1-2H3,(H2,33,39)(H,35,40)(H,36,42)(H,37,41)(H,43,44) |
| InChIKey | WHYRZPZCBHQYBX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |