C28H42N6O6 — CID 19945771
2-[[5-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid (PubChem CID 19945771) has the molecular formula C28H42N6O6 and a molecular weight of 558.68 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 19945771 |
| Molecular Formula | C28H42N6O6 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 2-[[5-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C28H42N6O6/c1-5-16(4)24(34-25(36)19(29)13-17-14-31-20-9-7-6-8-18(17)20)27(38)32-21(10-11-23(30)35)26(37)33-22(28(39)40)12-15(2)3/h6-9,14-16,19,21-22,24,31H,5,10-13,29H2,1-4H3,(H2,30,35)(H,32,38)(H,33,37)(H,34,36)(H,39,40) |
| InChIKey | ZCOIXGMYWXGFAF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 209.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |