C24H36N2O3 — CID 5244631
butyl 3-(1H-indol-3-yl)-2-(3,5,5-trimethylhexanoylamino)propanoate (PubChem CID 5244631) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is butyl 3-(1H-indol-3-yl)-2-(3,5,5-trimethylhexanoylamino)propanoate.
| Compound Name | butyl 3-(1H-indol-3-yl)-2-(3,5,5-trimethylhexanoylamino)propanoate |
|---|---|
| PubChem CID | 5244631 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | butyl 3-(1H-indol-3-yl)-2-(3,5,5-trimethylhexanoylamino)propanoate |
| SMILES | CCCCOC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C24H36N2O3/c1-6-7-12-29-23(28)21(26-22(27)13-17(2)15-24(3,4)5)14-18-16-25-20-11-9-8-10-19(18)20/h8-11,16-17,21,25H,6-7,12-15H2,1-5H3,(H,26,27) |
| InChIKey | RZNRNCBOXCSIBL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|