C21H26N4O4 — CID 3333545
butyl 2-[[2-(1-aminoethyl)-1,3-oxazole-4-carbonyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 3333545) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is butyl 2-[[2-(1-aminoethyl)-1,3-oxazole-4-carbonyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | butyl 2-[[2-(1-aminoethyl)-1,3-oxazole-4-carbonyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 3333545 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | butyl 2-[[2-(1-aminoethyl)-1,3-oxazole-4-carbonyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | CCCCOC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)c1coc(C(C)N)n1 |
| InChI | InChI=1S/C21H26N4O4/c1-3-4-9-28-21(27)17(10-14-11-23-16-8-6-5-7-15(14)16)24-19(26)18-12-29-20(25-18)13(2)22/h5-8,11-13,17,23H,3-4,9-10,22H2,1-2H3,(H,24,26) |
| InChIKey | MIYBNYMTXDDRLO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|