C27H30N4O4 — CID 4596844
butyl 2-[[2-(1-amino-2-phenylethyl)-1,3-oxazole-4-carbonyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 4596844) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is butyl 2-[[2-(1-amino-2-phenylethyl)-1,3-oxazole-4-carbonyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | butyl 2-[[2-(1-amino-2-phenylethyl)-1,3-oxazole-4-carbonyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 4596844 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | butyl 2-[[2-(1-amino-2-phenylethyl)-1,3-oxazole-4-carbonyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | CCCCOC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)c1coc(C(N)Cc2ccccc2)n1 |
| InChI | InChI=1S/C27H30N4O4/c1-2-3-13-34-27(33)23(15-19-16-29-22-12-8-7-11-20(19)22)30-25(32)24-17-35-26(31-24)21(28)14-18-9-5-4-6-10-18/h4-12,16-17,21,23,29H,2-3,13-15,28H2,1H3,(H,30,32) |
| InChIKey | MDCOYVAJSFLATM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|