C29H35N5O6S — CID 3311268
ethyl 2-[[2-[1-amino-2-(1H-indol-3-yl)ethyl]-1,3-oxazole-4-carbonyl]amino]-6-[(4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 3311268) has the molecular formula C29H35N5O6S and a molecular weight of 581.70 g/mol. Its IUPAC name is ethyl 2-[[2-[1-amino-2-(1H-indol-3-yl)ethyl]-1,3-oxazole-4-carbonyl]amino]-6-[(4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | ethyl 2-[[2-[1-amino-2-(1H-indol-3-yl)ethyl]-1,3-oxazole-4-carbonyl]amino]-6-[(4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 3311268 |
| Molecular Formula | C29H35N5O6S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | ethyl 2-[[2-[1-amino-2-(1H-indol-3-yl)ethyl]-1,3-oxazole-4-carbonyl]amino]-6-[(4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | CCOC(=O)C(CCCCNS(=O)(=O)c1ccc(C)cc1)NC(=O)c1coc(C(N)Cc2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C29H35N5O6S/c1-3-39-29(36)25(10-6-7-15-32-41(37,38)21-13-11-19(2)12-14-21)33-27(35)26-18-40-28(34-26)23(30)16-20-17-31-24-9-5-4-8-22(20)24/h4-5,8-9,11-14,17-18,23,25,31-32H,3,6-7,10,15-16,30H2,1-2H3,(H,33,35) |
| InChIKey | ZKNAHGVGVJRZNX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 169.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|