C18H26ClN3O3 — CID 110188518
[2-[[1-ethoxy-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-trimethylazanium chloride (PubChem CID 110188518) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is [2-[[1-ethoxy-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-trimethylazanium chloride.
| Compound Name | [2-[[1-ethoxy-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 110188518 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [2-[[1-ethoxy-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-trimethylazanium chloride |
| SMILES | CCOC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C18H25N3O3.ClH/c1-5-24-18(23)16(20-17(22)12-21(2,3)4)10-13-11-19-15-9-7-6-8-14(13)15;/h6-9,11,16,19H,5,10,12H2,1-4H3;1H |
| InChIKey | KQGPFWDCULVORT-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|