C19H18N4O5 — CID 15473987
(E)-N-(2,4-dinitrophenoxy)-4-(1H-indol-3-yl)-3-methylbutan-2-imine (PubChem CID 15473987) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is (E)-N-(2,4-dinitrophenoxy)-4-(1H-indol-3-yl)-3-methylbutan-2-imine.
| Compound Name | (E)-N-(2,4-dinitrophenoxy)-4-(1H-indol-3-yl)-3-methylbutan-2-imine |
|---|---|
| PubChem CID | 15473987 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (E)-N-(2,4-dinitrophenoxy)-4-(1H-indol-3-yl)-3-methylbutan-2-imine |
| SMILES | C/C(=N\Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(C)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18N4O5/c1-12(9-14-11-20-17-6-4-3-5-16(14)17)13(2)21-28-19-8-7-15(22(24)25)10-18(19)23(26)27/h3-8,10-12,20H,9H2,1-2H3/b21-13+ |
| InChIKey | PFMWZEUQOFGNBW-FYJGNVAPSA-N |
| XLogP | 4.62 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|