C38H37ClN8O10S2 — CID 159930802
4-[2-(2,4-dinitrophenyl)sulfanyl-1H-indol-3-yl]-3-(methylamino)butan-2-one;(2,4-dinitrophenyl) thiohypochlorite;4-(1H-indol-3-yl)-3-(methylamino)butan-2-one (PubChem CID 159930802) has the molecular formula C38H37ClN8O10S2 and a molecular weight of 865.35 g/mol. Its IUPAC name is 4-[2-(2,4-dinitrophenyl)sulfanyl-1H-indol-3-yl]-3-(methylamino)butan-2-one;(2,4-dinitrophenyl) thiohypochlorite;4-(1H-indol-3-yl)-3-(methylamino)butan-2-one.
| Compound Name | 4-[2-(2,4-dinitrophenyl)sulfanyl-1H-indol-3-yl]-3-(methylamino)butan-2-one;(2,4-dinitrophenyl) thiohypochlorite;4-(1H-indol-3-yl)-3-(methylamino)butan-2-one |
|---|---|
| PubChem CID | 159930802 |
| Molecular Formula | C38H37ClN8O10S2 |
| Molecular Weight | 865.35 g/mol |
| Exact Mass | 864.18 |
| IUPAC Name | 4-[2-(2,4-dinitrophenyl)sulfanyl-1H-indol-3-yl]-3-(methylamino)butan-2-one;(2,4-dinitrophenyl) thiohypochlorite;4-(1H-indol-3-yl)-3-(methylamino)butan-2-one |
| SMILES | CNC(Cc1c(Sc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])[nH]c2ccccc12)C(C)=O.CNC(Cc1c[nH]c2ccccc12)C(C)=O.O=[N+]([O-])c1ccc(SCl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N4O5S.C13H16N2O.C6H3ClN2O4S/c1-11(24)16(20-2)10-14-13-5-3-4-6-15(13)21-19(14)29-18-8-7-12(22(25)26)9-17(18)23(27)28;1-9(16)13(14-2)7-10-8-15-12-6-4-3-5-11(10)12;7-14-6-2-1-4(8(10)11)3-5(6)9(12)13/h3-9,16,20-21H,10H2,1-2H3;3-6,8,13-15H,7H2,1-2H3;1-3H |
| InChIKey | NZPOALWPXYTPGY-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 262.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.35 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|