C19H21N3O3 — CID 97322520
(2R)-3-(1H-indol-3-yl)-2-[[(1S)-1-(4-nitrophenyl)ethyl]amino]propan-1-ol (PubChem CID 97322520) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is (2R)-3-(1H-indol-3-yl)-2-[[(1S)-1-(4-nitrophenyl)ethyl]amino]propan-1-ol.
| Compound Name | (2R)-3-(1H-indol-3-yl)-2-[[(1S)-1-(4-nitrophenyl)ethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 97322520 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (2R)-3-(1H-indol-3-yl)-2-[[(1S)-1-(4-nitrophenyl)ethyl]amino]propan-1-ol |
| SMILES | C[C@H](N[C@@H](CO)Cc1c[nH]c2ccccc12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-13(14-6-8-17(9-7-14)22(24)25)21-16(12-23)10-15-11-20-19-5-3-2-4-18(15)19/h2-9,11,13,16,20-21,23H,10,12H2,1H3/t13-,16+/m0/s1 |
| InChIKey | KLHYEFPMIDSMDH-XJKSGUPXSA-N |
| XLogP | 3.33 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|