C28H30N6O6S — CID 70018055
methyl N-[3-[1-(benzenesulfonamido)ethyl]-1H-indol-5-yl]carbamate;2-(5-nitro-1H-indol-3-yl)ethanamine (PubChem CID 70018055) has the molecular formula C28H30N6O6S and a molecular weight of 578.65 g/mol. Its IUPAC name is methyl N-[3-[1-(benzenesulfonamido)ethyl]-1H-indol-5-yl]carbamate;2-(5-nitro-1H-indol-3-yl)ethanamine.
| Compound Name | methyl N-[3-[1-(benzenesulfonamido)ethyl]-1H-indol-5-yl]carbamate;2-(5-nitro-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 70018055 |
| Molecular Formula | C28H30N6O6S |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | methyl N-[3-[1-(benzenesulfonamido)ethyl]-1H-indol-5-yl]carbamate;2-(5-nitro-1H-indol-3-yl)ethanamine |
| SMILES | COC(=O)Nc1ccc2[nH]cc(C(C)NS(=O)(=O)c3ccccc3)c2c1.NCCc1c[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C18H19N3O4S.C10H11N3O2/c1-12(21-26(23,24)14-6-4-3-5-7-14)16-11-19-17-9-8-13(10-15(16)17)20-18(22)25-2;11-4-3-7-6-12-10-2-1-8(13(14)15)5-9(7)10/h3-12,19,21H,1-2H3,(H,20,22);1-2,5-6,12H,3-4,11H2 |
| InChIKey | GIZQPHITLGCHNQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 185.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|