C22H26N4O5S — CID 21276195
1-[3-(2-aminoethyl)-1H-indol-5-yl]-3-methylurea;naphthalene-2-sulfonic acid;hydrate (PubChem CID 21276195) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is 1-[3-(2-aminoethyl)-1H-indol-5-yl]-3-methylurea;naphthalene-2-sulfonic acid;hydrate.
| Compound Name | 1-[3-(2-aminoethyl)-1H-indol-5-yl]-3-methylurea;naphthalene-2-sulfonic acid;hydrate |
|---|---|
| PubChem CID | 21276195 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-[3-(2-aminoethyl)-1H-indol-5-yl]-3-methylurea;naphthalene-2-sulfonic acid;hydrate |
| SMILES | CNC(=O)Nc1ccc2[nH]cc(CCN)c2c1.O.O=S(=O)(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H16N4O.C10H8O3S.H2O/c1-14-12(17)16-9-2-3-11-10(6-9)8(4-5-13)7-15-11;11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;/h2-3,6-7,15H,4-5,13H2,1H3,(H2,14,16,17);1-7H,(H,11,12,13);1H2 |
| InChIKey | WHSGZGSRMFGRMO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 168.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|