C23H18ClN3O3 — CID 42808765
3-(5-chloro-1H-indol-3-yl)-3-(3-nitrophenyl)-N-phenylpropanamide (PubChem CID 42808765) has the molecular formula C23H18ClN3O3 and a molecular weight of 419.87 g/mol. Its IUPAC name is 3-(5-chloro-1H-indol-3-yl)-3-(3-nitrophenyl)-N-phenylpropanamide.
| Compound Name | 3-(5-chloro-1H-indol-3-yl)-3-(3-nitrophenyl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 42808765 |
| Molecular Formula | C23H18ClN3O3 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 3-(5-chloro-1H-indol-3-yl)-3-(3-nitrophenyl)-N-phenylpropanamide |
| SMILES | O=C(CC(c1cccc([N+](=O)[O-])c1)c1c[nH]c2ccc(Cl)cc12)Nc1ccccc1 |
| InChI | InChI=1S/C23H18ClN3O3/c24-16-9-10-22-20(12-16)21(14-25-22)19(15-5-4-8-18(11-15)27(29)30)13-23(28)26-17-6-2-1-3-7-17/h1-12,14,19,25H,13H2,(H,26,28) |
| InChIKey | DYYLWTYBLYYGAN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|