C11H19N3O5 — CID 19851147
hydrazine;3-[4-(2-hydroxyethyl)-2-nitrophenyl]propane-1,2-diol (PubChem CID 19851147) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is hydrazine;3-[4-(2-hydroxyethyl)-2-nitrophenyl]propane-1,2-diol.
| Compound Name | hydrazine;3-[4-(2-hydroxyethyl)-2-nitrophenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 19851147 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | hydrazine;3-[4-(2-hydroxyethyl)-2-nitrophenyl]propane-1,2-diol |
| SMILES | NN.O=[N+]([O-])c1cc(CCO)ccc1CC(O)CO |
| InChI | InChI=1S/C11H15NO5.H4N2/c13-4-3-8-1-2-9(6-10(15)7-14)11(5-8)12(16)17;1-2/h1-2,5,10,13-15H,3-4,6-7H2;1-2H2 |
| InChIKey | PJAMGDOMZLAGRJ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 155.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|