C12H12N2O4 — CID 58780824
3-(5-nitroisoquinolin-4-yl)propane-1,2-diol (PubChem CID 58780824) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-(5-nitroisoquinolin-4-yl)propane-1,2-diol.
| Compound Name | 3-(5-nitroisoquinolin-4-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 58780824 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-(5-nitroisoquinolin-4-yl)propane-1,2-diol |
| SMILES | O=[N+]([O-])c1cccc2cncc(CC(O)CO)c12 |
| InChI | InChI=1S/C12H12N2O4/c15-7-10(16)4-9-6-13-5-8-2-1-3-11(12(8)9)14(17)18/h1-3,5-6,10,15-16H,4,7H2 |
| InChIKey | YOAGTEZMBCISPN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|